![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Air Fryer Cookbook--..> | 2017-07-28 18:56 | 8.9M | |
| Artisan Vegan Cheese..> | 2017-07-28 18:56 | 1.8M | |
| Bread/ | 2016-11-13 10:17 | - | |
| Bryant Terry - Vegan..> | 2022-06-20 19:57 | 4.9M | |
| Bryant Terry - Veget..> | 2022-06-20 19:52 | 80M | |
| Candle79-Cookbook.pdf | 2017-07-28 18:57 | 10M | |
| Chinese Vegetarian C..> | 2018-10-12 22:25 | 1.1M | |
| Chloe's Vegan Italia..> | 2017-07-28 18:57 | 31M | |
| Chloe Coscarelli - C..> | 2017-07-28 18:57 | 6.9M | |
| Chloe Flavor - Chloe..> | 2018-03-31 12:51 | 102M | |
| FarmVegetarianCookbook/ | 2016-12-31 19:41 | - | |
| FarmVegetarianCookbo..> | 2016-12-31 19:41 | - | |
| Field Roast - Tommy ..> | 2018-03-19 09:25 | 82M | |
| Food52 Vegan_ 60 Veg..> | 2017-07-28 18:57 | 67M | |
| Gourmet Vegetarian S..> | 2018-10-12 22:29 | 3.0M | |
| Low-Fodmap and Vegan..> | 2020-01-26 15:37 | 3.6M | |
| Mayim's Vegan Table-..> | 2017-07-28 18:57 | 9.6M | |
| Minimalist Baker's E..> | 2017-07-28 18:57 | 65M | |
| Misc/ | 2025-02-17 21:49 | - | |
| MissionChinese/ | 2022-10-02 17:35 | - | |
| No Picnic Your Punk ..> | 2017-12-09 16:15 | 12M | |
| Nut Butter Cookbook ..> | 2017-07-28 18:57 | 3.7M | |
| RECIPES & FOOD STUFF/ | 2017-02-05 20:53 | - | |
| Recipes/ | 2016-11-23 23:39 | - | |
| Sinfully Vegan More ..> | 2017-07-28 18:57 | 2.0M | |
| SoulVegetarianCookbook/ | 2016-12-31 19:40 | - | |
| South.Of.The.Border-..> | 2017-07-28 18:57 | 361K | |
| Superiority Burger C..> | 2018-06-09 15:51 | 50M | |
| The Blossom Cookbook..> | 2017-07-28 18:57 | 52M | |
| The Chinese Vegan Ki..> | 2017-07-28 18:57 | 1.8M | |
| The New Jewish Table..> | 2018-08-25 10:04 | 13M | |
| The New Mediterranea..> | 2018-08-25 10:05 | 9.6M | |
| The Oh She Glows Coo..> | 2016-09-11 11:23 | 56M | |
| TheSopranosFamilyCoo..> | 2020-04-30 22:31 | 3.6M | |
| The Vegan Air Fryer_..> | 2017-07-28 18:57 | 17M | |
| This Ain't No Picnic..> | 2017-07-28 18:57 | 12M | |
| Thug Kitchen The Off..> | 2017-07-28 18:57 | 13M | |
| VBQ-The Ultimate Veg..> | 2018-06-09 09:44 | 41M | |
| VeganHolidayCooking-..> | 2017-07-28 18:57 | 4.7M | |
| Vegan Richa's Indian..> | 2017-09-09 22:31 | 25M | |
| Vegan Soul Kitchen--..> | 2022-06-20 19:57 | 4.9M | |
| Vegan Under Pressure..> | 2017-07-28 18:57 | 7.0M | |
| Veggie Burger Atelie..> | 2018-06-10 17:42 | 67M | |
| Whole Grain Vegan Ba..> | 2017-07-28 18:57 | 26M | |
| Zahav - Michael Solo..> | 2017-07-28 18:57 | 118M | |
| azw/ | 2016-07-04 00:07 | - | |
| doc/ | 2014-10-13 12:51 | - | |
| epub/ | 2020-01-26 15:38 | - | |
| html/ | 2014-10-13 12:51 | - | |
| htmlz/ | 2016-12-17 22:25 | - | |
| wholefoodrecipe_cook..> | 2017-07-28 18:57 | 35M | |